C18H24N4OS — CID 96521496
N-[(3S)-3-cyanothiolan-3-yl]-3-[(4-methylpiperazin-1-yl)methyl]benzamide (PubChem CID 96521496) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is N-[(3S)-3-cyanothiolan-3-yl]-3-[(4-methylpiperazin-1-yl)methyl]benzamide.
| Compound Name | N-[(3S)-3-cyanothiolan-3-yl]-3-[(4-methylpiperazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 96521496 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N-[(3S)-3-cyanothiolan-3-yl]-3-[(4-methylpiperazin-1-yl)methyl]benzamide |
| SMILES | CN1CCN(Cc2cccc(C(=O)N[C@]3(C#N)CCSC3)c2)CC1 |
| InChI | InChI=1S/C18H24N4OS/c1-21-6-8-22(9-7-21)12-15-3-2-4-16(11-15)17(23)20-18(13-19)5-10-24-14-18/h2-4,11H,5-10,12,14H2,1H3,(H,20,23)/t18-/m0/s1 |
| InChIKey | DLGMTRGXUHMAGZ-SFHVURJKSA-N |
| XLogP | 1.56 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |