C20H28ClN3S — CID 96522113
(3R,4S)-N-[(2-chloro-7-methylsulfanylquinolin-3-yl)methyl]-1-ethyl-N,3-dimethylpiperidin-4-amine (PubChem CID 96522113) has the molecular formula C20H28ClN3S and a molecular weight of 377.99 g/mol. Its IUPAC name is (3R,4S)-N-[(2-chloro-7-methylsulfanylquinolin-3-yl)methyl]-1-ethyl-N,3-dimethylpiperidin-4-amine.
| Compound Name | (3R,4S)-N-[(2-chloro-7-methylsulfanylquinolin-3-yl)methyl]-1-ethyl-N,3-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 96522113 |
| Molecular Formula | C20H28ClN3S |
| Molecular Weight | 377.99 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | (3R,4S)-N-[(2-chloro-7-methylsulfanylquinolin-3-yl)methyl]-1-ethyl-N,3-dimethylpiperidin-4-amine |
| SMILES | CCN1CC[C@H](N(C)Cc2cc3ccc(SC)cc3nc2Cl)[C@H](C)C1 |
| InChI | InChI=1S/C20H28ClN3S/c1-5-24-9-8-19(14(2)12-24)23(3)13-16-10-15-6-7-17(25-4)11-18(15)22-20(16)21/h6-7,10-11,14,19H,5,8-9,12-13H2,1-4H3/t14-,19+/m1/s1 |
| InChIKey | PGEKTUCFYIHRFP-KUHUBIRLSA-N |
| XLogP | 4.77 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.99 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|