C25H19N3O4 — CID 96522220
N-(9,10-dioxoanthracen-2-yl)-2-[(2S)-2-methyl-3-oxo-2,4-dihydroquinoxalin-1-yl]acetamide (PubChem CID 96522220) has the molecular formula C25H19N3O4 and a molecular weight of 425.44 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-2-yl)-2-[(2S)-2-methyl-3-oxo-2,4-dihydroquinoxalin-1-yl]acetamide.
| Compound Name | N-(9,10-dioxoanthracen-2-yl)-2-[(2S)-2-methyl-3-oxo-2,4-dihydroquinoxalin-1-yl]acetamide |
|---|---|
| PubChem CID | 96522220 |
| Molecular Formula | C25H19N3O4 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | N-(9,10-dioxoanthracen-2-yl)-2-[(2S)-2-methyl-3-oxo-2,4-dihydroquinoxalin-1-yl]acetamide |
| SMILES | C[C@H]1C(=O)Nc2ccccc2N1CC(=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C25H19N3O4/c1-14-25(32)27-20-8-4-5-9-21(20)28(14)13-22(29)26-15-10-11-18-19(12-15)24(31)17-7-3-2-6-16(17)23(18)30/h2-12,14H,13H2,1H3,(H,26,29)(H,27,32)/t14-/m0/s1 |
| InChIKey | GLFQIKNQUZMTKT-AWEZNQCLSA-N |
| XLogP | 3.25 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|