About (1R)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-(4-fluorophenyl)-N-methylethanamine
(1R)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-(4-fluorophenyl)-N-methylethanamine (PubChem CID 96522250) has the molecular formula C15H19FN2S
and a molecular weight of 278.40 g/mol. Its IUPAC name is (1R)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-(4-fluorophenyl)-N-methylethanamine.
Molecular Properties
| Compound Name | (1R)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-(4-fluorophenyl)-N-methylethanamine |
| PubChem CID | 96522250 |
| Molecular Formula | C15H19FN2S |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (1R)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-(4-fluorophenyl)-N-methylethanamine |
| SMILES | Cc1nc(CN(C)[C@H](C)c2ccc(F)cc2)sc1C |
| InChI | InChI=1S/C15H19FN2S/c1-10-12(3)19-15(17-10)9-18(4)11(2)13-5-7-14(16)8-6-13/h5-8,11H,9H2,1-4H3/t11-/m1/s1 |
| InChIKey | YKAAIKKUZQRCOU-LLVKDONJSA-N |
| XLogP | 4.09 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-(4-fluorophenyl)-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-(4-fluorophenyl)-N-methylethanamine?
The IUPAC name of (1R)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-(4-fluorophenyl)-N-methylethanamine (CID 96522250) is (1R)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-(4-fluorophenyl)-N-methylethanamine.
What is the SMILES notation for (1R)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-(4-fluorophenyl)-N-methylethanamine?
The canonical SMILES for (1R)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-(4-fluorophenyl)-N-methylethanamine is Cc1nc(CN(C)[C@H](C)c2ccc(F)cc2)sc1C.
What is the InChIKey of (1R)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-(4-fluorophenyl)-N-methylethanamine?
The InChIKey is YKAAIKKUZQRCOU-LLVKDONJSA-N. The full InChI is InChI=1S/C15H19FN2S/c1-10-12(3)19-15(17-10)9-18(4)11(2)13-5-7-14(16)8-6-13/h5-8,11H,9H2,1-4H3/t11-/m1/s1.
What are the key properties of (1R)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-(4-fluorophenyl)-N-methylethanamine?
(1R)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-(4-fluorophenyl)-N-methylethanamine has a molecular weight of 278.40 g/mol, XLogP of 4.09, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-(4-fluorophenyl)-N-methylethanamine is sourced from PubChem (CID 96522250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).