C14H21NO2 — CID 96522716
(2R)-2-methoxy-N-[(2S,3R)-3-phenylbutan-2-yl]propanamide (PubChem CID 96522716) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is (2R)-2-methoxy-N-[(2S,3R)-3-phenylbutan-2-yl]propanamide.
| Compound Name | (2R)-2-methoxy-N-[(2S,3R)-3-phenylbutan-2-yl]propanamide |
|---|---|
| PubChem CID | 96522716 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | (2R)-2-methoxy-N-[(2S,3R)-3-phenylbutan-2-yl]propanamide |
| SMILES | CO[C@H](C)C(=O)N[C@@H](C)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C14H21NO2/c1-10(13-8-6-5-7-9-13)11(2)15-14(16)12(3)17-4/h5-12H,1-4H3,(H,15,16)/t10-,11-,12+/m0/s1 |
| InChIKey | FOHTXAJZYGDIFL-SDDRHHMPSA-N |
| XLogP | 2.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |