C20H24N4O3S — CID 96522754
1-[2-[(S)-methylsulfinyl]phenyl]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]urea (PubChem CID 96522754) has the molecular formula C20H24N4O3S and a molecular weight of 400.50 g/mol. Its IUPAC name is 1-[2-[(S)-methylsulfinyl]phenyl]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]urea.
| Compound Name | 1-[2-[(S)-methylsulfinyl]phenyl]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 96522754 |
| Molecular Formula | C20H24N4O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 1-[2-[(S)-methylsulfinyl]phenyl]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]urea |
| SMILES | C[S@](=O)c1ccccc1NC(=O)NCC(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H24N4O3S/c1-28(27)18-10-6-5-9-17(18)22-20(26)21-15-19(25)24-13-11-23(12-14-24)16-7-3-2-4-8-16/h2-10H,11-15H2,1H3,(H2,21,22,26)/t28-/m0/s1 |
| InChIKey | ALLRFHKNVAPPSJ-NDEPHWFRSA-N |
| XLogP | 1.89 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |