C16H19NO4S — CID 96523603
[(1S,2R)-2-methoxycyclopentyl] 2-(3-oxo-1,4-benzothiazin-4-yl)acetate (PubChem CID 96523603) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is [(1S,2R)-2-methoxycyclopentyl] 2-(3-oxo-1,4-benzothiazin-4-yl)acetate.
| Compound Name | [(1S,2R)-2-methoxycyclopentyl] 2-(3-oxo-1,4-benzothiazin-4-yl)acetate |
|---|---|
| PubChem CID | 96523603 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | [(1S,2R)-2-methoxycyclopentyl] 2-(3-oxo-1,4-benzothiazin-4-yl)acetate |
| SMILES | CO[C@@H]1CCC[C@@H]1OC(=O)CN1C(=O)CSc2ccccc21 |
| InChI | InChI=1S/C16H19NO4S/c1-20-12-6-4-7-13(12)21-16(19)9-17-11-5-2-3-8-14(11)22-10-15(17)18/h2-3,5,8,12-13H,4,6-7,9-10H2,1H3/t12-,13+/m1/s1 |
| InChIKey | NKIVRMBHWTYBQQ-OLZOCXBDSA-N |
| XLogP | 2.24 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |