About 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[(1S)-2-hydroxy-1-phenylethyl]urea
1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[(1S)-2-hydroxy-1-phenylethyl]urea (PubChem CID 96524437) has the molecular formula C16H18ClN3O2
and a molecular weight of 319.79 g/mol. Its IUPAC name is 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[(1S)-2-hydroxy-1-phenylethyl]urea.
Molecular Properties
| Compound Name | 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[(1S)-2-hydroxy-1-phenylethyl]urea |
| PubChem CID | 96524437 |
| Molecular Formula | C16H18ClN3O2 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[(1S)-2-hydroxy-1-phenylethyl]urea |
| SMILES | Cc1cc(C)c(NC(=O)N[C@H](CO)c2ccccc2)c(Cl)n1 |
| InChI | InChI=1S/C16H18ClN3O2/c1-10-8-11(2)18-15(17)14(10)20-16(22)19-13(9-21)12-6-4-3-5-7-12/h3-8,13,21H,9H2,1-2H3,(H2,19,20,22)/t13-/m1/s1 |
| InChIKey | PCSZWKCJUFAOAR-CYBMUJFWSA-N |
| XLogP | 3.21 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[(1S)-2-hydroxy-1-phenylethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[(1S)-2-hydroxy-1-phenylethyl]urea?
The IUPAC name of 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[(1S)-2-hydroxy-1-phenylethyl]urea (CID 96524437) is 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[(1S)-2-hydroxy-1-phenylethyl]urea.
What is the SMILES notation for 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[(1S)-2-hydroxy-1-phenylethyl]urea?
The canonical SMILES for 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[(1S)-2-hydroxy-1-phenylethyl]urea is Cc1cc(C)c(NC(=O)N[C@H](CO)c2ccccc2)c(Cl)n1.
What is the InChIKey of 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[(1S)-2-hydroxy-1-phenylethyl]urea?
The InChIKey is PCSZWKCJUFAOAR-CYBMUJFWSA-N. The full InChI is InChI=1S/C16H18ClN3O2/c1-10-8-11(2)18-15(17)14(10)20-16(22)19-13(9-21)12-6-4-3-5-7-12/h3-8,13,21H,9H2,1-2H3,(H2,19,20,22)/t13-/m1/s1.
What are the key properties of 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[(1S)-2-hydroxy-1-phenylethyl]urea?
1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[(1S)-2-hydroxy-1-phenylethyl]urea has a molecular weight of 319.79 g/mol, XLogP of 3.21, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[(1S)-2-hydroxy-1-phenylethyl]urea is sourced from PubChem (CID 96524437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).