C12H15NO3S — CID 96525480
2-hydroxy-5-methyl-N-[(1S,3R)-1-oxothiolan-3-yl]benzamide (PubChem CID 96525480) has the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. Its IUPAC name is 2-hydroxy-5-methyl-N-[(1S,3R)-1-oxothiolan-3-yl]benzamide.
| Compound Name | 2-hydroxy-5-methyl-N-[(1S,3R)-1-oxothiolan-3-yl]benzamide |
|---|---|
| PubChem CID | 96525480 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 2-hydroxy-5-methyl-N-[(1S,3R)-1-oxothiolan-3-yl]benzamide |
| SMILES | Cc1ccc(O)c(C(=O)N[C@@H]2CC[S@](=O)C2)c1 |
| InChI | InChI=1S/C12H15NO3S/c1-8-2-3-11(14)10(6-8)12(15)13-9-4-5-17(16)7-9/h2-3,6,9,14H,4-5,7H2,1H3,(H,13,15)/t9-,17+/m1/s1 |
| InChIKey | ORKLPVXUXWDVIQ-XLFHBGCDSA-N |
| XLogP | 0.95 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |