About 5-[(2S,6R)-2,6-dimethylazepane-1-carbonyl]-N-methylthiophene-3-sulfonamide
5-[(2S,6R)-2,6-dimethylazepane-1-carbonyl]-N-methylthiophene-3-sulfonamide (PubChem CID 96527844) has the molecular formula C14H22N2O3S2
and a molecular weight of 330.48 g/mol. Its IUPAC name is 5-[(2S,6R)-2,6-dimethylazepane-1-carbonyl]-N-methylthiophene-3-sulfonamide.
Molecular Properties
| Compound Name | 5-[(2S,6R)-2,6-dimethylazepane-1-carbonyl]-N-methylthiophene-3-sulfonamide |
| PubChem CID | 96527844 |
| Molecular Formula | C14H22N2O3S2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 5-[(2S,6R)-2,6-dimethylazepane-1-carbonyl]-N-methylthiophene-3-sulfonamide |
| SMILES | CNS(=O)(=O)c1csc(C(=O)N2C[C@H](C)CCC[C@@H]2C)c1 |
| InChI | InChI=1S/C14H22N2O3S2/c1-10-5-4-6-11(2)16(8-10)14(17)13-7-12(9-20-13)21(18,19)15-3/h7,9-11,15H,4-6,8H2,1-3H3/t10-,11+/m1/s1 |
| InChIKey | DIYCHQQKXZSVAW-MNOVXSKESA-N |
| XLogP | 2.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(2S,6R)-2,6-dimethylazepane-1-carbonyl]-N-methylthiophene-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2S,6R)-2,6-dimethylazepane-1-carbonyl]-N-methylthiophene-3-sulfonamide?
The IUPAC name of 5-[(2S,6R)-2,6-dimethylazepane-1-carbonyl]-N-methylthiophene-3-sulfonamide (CID 96527844) is 5-[(2S,6R)-2,6-dimethylazepane-1-carbonyl]-N-methylthiophene-3-sulfonamide.
What is the SMILES notation for 5-[(2S,6R)-2,6-dimethylazepane-1-carbonyl]-N-methylthiophene-3-sulfonamide?
The canonical SMILES for 5-[(2S,6R)-2,6-dimethylazepane-1-carbonyl]-N-methylthiophene-3-sulfonamide is CNS(=O)(=O)c1csc(C(=O)N2C[C@H](C)CCC[C@@H]2C)c1.
What is the InChIKey of 5-[(2S,6R)-2,6-dimethylazepane-1-carbonyl]-N-methylthiophene-3-sulfonamide?
The InChIKey is DIYCHQQKXZSVAW-MNOVXSKESA-N. The full InChI is InChI=1S/C14H22N2O3S2/c1-10-5-4-6-11(2)16(8-10)14(17)13-7-12(9-20-13)21(18,19)15-3/h7,9-11,15H,4-6,8H2,1-3H3/t10-,11+/m1/s1.
What are the key properties of 5-[(2S,6R)-2,6-dimethylazepane-1-carbonyl]-N-methylthiophene-3-sulfonamide?
5-[(2S,6R)-2,6-dimethylazepane-1-carbonyl]-N-methylthiophene-3-sulfonamide has a molecular weight of 330.48 g/mol, XLogP of 2.31, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2S,6R)-2,6-dimethylazepane-1-carbonyl]-N-methylthiophene-3-sulfonamide is sourced from PubChem (CID 96527844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).