C17H27N3O2 — CID 96528343
N-[3-[[4-[(2S)-1-methoxypropan-2-yl]piperazin-1-yl]methyl]phenyl]acetamide (PubChem CID 96528343) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is N-[3-[[4-[(2S)-1-methoxypropan-2-yl]piperazin-1-yl]methyl]phenyl]acetamide.
| Compound Name | N-[3-[[4-[(2S)-1-methoxypropan-2-yl]piperazin-1-yl]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 96528343 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | N-[3-[[4-[(2S)-1-methoxypropan-2-yl]piperazin-1-yl]methyl]phenyl]acetamide |
| SMILES | COC[C@H](C)N1CCN(Cc2cccc(NC(C)=O)c2)CC1 |
| InChI | InChI=1S/C17H27N3O2/c1-14(13-22-3)20-9-7-19(8-10-20)12-16-5-4-6-17(11-16)18-15(2)21/h4-6,11,14H,7-10,12-13H2,1-3H3,(H,18,21)/t14-/m0/s1 |
| InChIKey | UZZOARVRUIRKHP-AWEZNQCLSA-N |
| XLogP | 1.80 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |