C20H27N3O3S — CID 96529115
tert-butyl (3S)-3-cyano-4-[4-(ethylsulfanylmethyl)benzoyl]piperazine-1-carboxylate (PubChem CID 96529115) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is tert-butyl (3S)-3-cyano-4-[4-(ethylsulfanylmethyl)benzoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-cyano-4-[4-(ethylsulfanylmethyl)benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 96529115 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | tert-butyl (3S)-3-cyano-4-[4-(ethylsulfanylmethyl)benzoyl]piperazine-1-carboxylate |
| SMILES | CCSCc1ccc(C(=O)N2CCN(C(=O)OC(C)(C)C)C[C@H]2C#N)cc1 |
| InChI | InChI=1S/C20H27N3O3S/c1-5-27-14-15-6-8-16(9-7-15)18(24)23-11-10-22(13-17(23)12-21)19(25)26-20(2,3)4/h6-9,17H,5,10-11,13-14H2,1-4H3/t17-/m1/s1 |
| InChIKey | YAKANWVKTIJIJO-QGZVFWFLSA-N |
| XLogP | 3.52 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |