C15H17F4N3O2 — CID 96531145
N-[(1R)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]-3-(2,2,3,3-tetrafluoropropoxymethyl)aniline (PubChem CID 96531145) has the molecular formula C15H17F4N3O2 and a molecular weight of 347.31 g/mol. Its IUPAC name is N-[(1R)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]-3-(2,2,3,3-tetrafluoropropoxymethyl)aniline.
| Compound Name | N-[(1R)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]-3-(2,2,3,3-tetrafluoropropoxymethyl)aniline |
|---|---|
| PubChem CID | 96531145 |
| Molecular Formula | C15H17F4N3O2 |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-[(1R)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]-3-(2,2,3,3-tetrafluoropropoxymethyl)aniline |
| SMILES | Cc1nnc([C@@H](C)Nc2cccc(COCC(F)(F)C(F)F)c2)o1 |
| InChI | InChI=1S/C15H17F4N3O2/c1-9(13-22-21-10(2)24-13)20-12-5-3-4-11(6-12)7-23-8-15(18,19)14(16)17/h3-6,9,14,20H,7-8H2,1-2H3/t9-/m1/s1 |
| InChIKey | ILOXIVHAYZRJQR-SECBINFHSA-N |
| XLogP | 3.97 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|