C13H14F4N2O3 — CID 96531386
(3R,5S)-5-methyl-3-[[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]amino]oxolan-2-one (PubChem CID 96531386) has the molecular formula C13H14F4N2O3 and a molecular weight of 322.26 g/mol. Its IUPAC name is (3R,5S)-5-methyl-3-[[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]amino]oxolan-2-one.
| Compound Name | (3R,5S)-5-methyl-3-[[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]amino]oxolan-2-one |
|---|---|
| PubChem CID | 96531386 |
| Molecular Formula | C13H14F4N2O3 |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | (3R,5S)-5-methyl-3-[[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]amino]oxolan-2-one |
| SMILES | C[C@H]1C[C@@H](Nc2ccc(OCC(F)(F)C(F)F)nc2)C(=O)O1 |
| InChI | InChI=1S/C13H14F4N2O3/c1-7-4-9(11(20)22-7)19-8-2-3-10(18-5-8)21-6-13(16,17)12(14)15/h2-3,5,7,9,12,19H,4,6H2,1H3/t7-,9+/m0/s1 |
| InChIKey | CINGVQJERSWHQB-IONNQARKSA-N |
| XLogP | 2.48 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|