About (3R,5R)-3,5-difluoropiperidine
(3R,5R)-3,5-difluoropiperidine (PubChem CID 96532302) has the molecular formula C5H9F2N
and a molecular weight of 121.13 g/mol. Its IUPAC name is (3R,5R)-3,5-difluoropiperidine.
Molecular Properties
| Compound Name | (3R,5R)-3,5-difluoropiperidine |
| PubChem CID | 96532302 |
| Molecular Formula | C5H9F2N |
| Molecular Weight | 121.13 g/mol |
| Exact Mass | 121.07 |
| IUPAC Name | (3R,5R)-3,5-difluoropiperidine |
| SMILES | F[C@H]1CNC[C@H](F)C1 |
| InChI | InChI=1S/C5H9F2N/c6-4-1-5(7)3-8-2-4/h4-5,8H,1-3H2/t4-,5-/m1/s1 |
| InChIKey | FXAZVBOIOYBLII-RFZPGFLSSA-N |
| XLogP | 0.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.13 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R,5R)-3,5-difluoropiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5R)-3,5-difluoropiperidine?
The IUPAC name of (3R,5R)-3,5-difluoropiperidine (CID 96532302) is (3R,5R)-3,5-difluoropiperidine.
What is the SMILES notation for (3R,5R)-3,5-difluoropiperidine?
The canonical SMILES for (3R,5R)-3,5-difluoropiperidine is F[C@H]1CNC[C@H](F)C1.
What is the InChIKey of (3R,5R)-3,5-difluoropiperidine?
The InChIKey is FXAZVBOIOYBLII-RFZPGFLSSA-N. The full InChI is InChI=1S/C5H9F2N/c6-4-1-5(7)3-8-2-4/h4-5,8H,1-3H2/t4-,5-/m1/s1.
What are the key properties of (3R,5R)-3,5-difluoropiperidine?
(3R,5R)-3,5-difluoropiperidine has a molecular weight of 121.13 g/mol, XLogP of 0.66, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5R)-3,5-difluoropiperidine is sourced from PubChem (CID 96532302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).