C17H20ClN3O3S — CID 96532543
2-[4-[(S)-(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]pyridine-3-sulfonamide (PubChem CID 96532543) has the molecular formula C17H20ClN3O3S and a molecular weight of 381.89 g/mol. Its IUPAC name is 2-[4-[(S)-(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]pyridine-3-sulfonamide.
| Compound Name | 2-[4-[(S)-(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 96532543 |
| Molecular Formula | C17H20ClN3O3S |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 2-[4-[(S)-(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1cccnc1N1CCC([C@H](O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H20ClN3O3S/c18-14-5-3-12(4-6-14)16(22)13-7-10-21(11-8-13)17-15(25(19,23)24)2-1-9-20-17/h1-6,9,13,16,22H,7-8,10-11H2,(H2,19,23,24)/t16-/m1/s1 |
| InChIKey | HIJAHHVBJDVCJM-MRXNPFEDSA-N |
| XLogP | 2.33 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |