C15H19ClFNO3 — CID 96533309
(2R)-2-(2-chloro-4-fluorophenoxy)-N-[2-[(2S)-oxolan-2-yl]ethyl]propanamide (PubChem CID 96533309) has the molecular formula C15H19ClFNO3 and a molecular weight of 315.77 g/mol. Its IUPAC name is (2R)-2-(2-chloro-4-fluorophenoxy)-N-[2-[(2S)-oxolan-2-yl]ethyl]propanamide.
| Compound Name | (2R)-2-(2-chloro-4-fluorophenoxy)-N-[2-[(2S)-oxolan-2-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 96533309 |
| Molecular Formula | C15H19ClFNO3 |
| Molecular Weight | 315.77 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | (2R)-2-(2-chloro-4-fluorophenoxy)-N-[2-[(2S)-oxolan-2-yl]ethyl]propanamide |
| SMILES | C[C@@H](Oc1ccc(F)cc1Cl)C(=O)NCC[C@@H]1CCCO1 |
| InChI | InChI=1S/C15H19ClFNO3/c1-10(21-14-5-4-11(17)9-13(14)16)15(19)18-7-6-12-3-2-8-20-12/h4-5,9-10,12H,2-3,6-8H2,1H3,(H,18,19)/t10-,12+/m1/s1 |
| InChIKey | BFVHEKFYLTUQHC-PWSUYJOCSA-N |
| XLogP | 2.93 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.77 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |