C17H23N3O3S — CID 96533462
1-[(3S)-1-[2-(3-methoxyphenyl)sulfanylacetyl]piperidin-3-yl]imidazolidin-2-one (PubChem CID 96533462) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is 1-[(3S)-1-[2-(3-methoxyphenyl)sulfanylacetyl]piperidin-3-yl]imidazolidin-2-one.
| Compound Name | 1-[(3S)-1-[2-(3-methoxyphenyl)sulfanylacetyl]piperidin-3-yl]imidazolidin-2-one |
|---|---|
| PubChem CID | 96533462 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 1-[(3S)-1-[2-(3-methoxyphenyl)sulfanylacetyl]piperidin-3-yl]imidazolidin-2-one |
| SMILES | COc1cccc(SCC(=O)N2CCC[C@H](N3CCNC3=O)C2)c1 |
| InChI | InChI=1S/C17H23N3O3S/c1-23-14-5-2-6-15(10-14)24-12-16(21)19-8-3-4-13(11-19)20-9-7-18-17(20)22/h2,5-6,10,13H,3-4,7-9,11-12H2,1H3,(H,18,22)/t13-/m0/s1 |
| InChIKey | GSQXZCMWBZIGIA-ZDUSSCGKSA-N |
| XLogP | 1.80 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |