C16H15F2N5O2 — CID 96533877
(9aS)-2-[2-(difluoromethyl)quinazolin-4-yl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-6,7-dione (PubChem CID 96533877) has the molecular formula C16H15F2N5O2 and a molecular weight of 347.33 g/mol. Its IUPAC name is (9aS)-2-[2-(difluoromethyl)quinazolin-4-yl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-6,7-dione.
| Compound Name | (9aS)-2-[2-(difluoromethyl)quinazolin-4-yl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-6,7-dione |
|---|---|
| PubChem CID | 96533877 |
| Molecular Formula | C16H15F2N5O2 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | (9aS)-2-[2-(difluoromethyl)quinazolin-4-yl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-6,7-dione |
| SMILES | O=C1NC[C@H]2CN(c3nc(C(F)F)nc4ccccc34)CCN2C1=O |
| InChI | InChI=1S/C16H15F2N5O2/c17-12(18)13-20-11-4-2-1-3-10(11)14(21-13)22-5-6-23-9(8-22)7-19-15(24)16(23)25/h1-4,9,12H,5-8H2,(H,19,24)/t9-/m0/s1 |
| InChIKey | BJXZGBNYKOGLNX-VIFPVBQESA-N |
| XLogP | 0.71 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|