C20H19N7OS — CID 96534362
N-[(8S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-1-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide (PubChem CID 96534362) has the molecular formula C20H19N7OS and a molecular weight of 405.49 g/mol. Its IUPAC name is N-[(8S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-1-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[(8S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-1-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 96534362 |
| Molecular Formula | C20H19N7OS |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | N-[(8S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-1-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1nc2n(n1)CCC[C@@H]2NC(=O)c1nc(-c2cccs2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H19N7OS/c1-13-21-18-15(9-5-11-26(18)24-13)22-20(28)17-23-19(16-10-6-12-29-16)27(25-17)14-7-3-2-4-8-14/h2-4,6-8,10,12,15H,5,9,11H2,1H3,(H,22,28)/t15-/m0/s1 |
| InChIKey | QOJZHRNVJSFMIR-HNNXBMFYSA-N |
| XLogP | 3.16 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |