C19H21F2NO3S — CID 96534711
4-(difluoromethylsulfonylmethyl)-N-[(1S)-1-(4-ethylphenyl)ethyl]benzamide (PubChem CID 96534711) has the molecular formula C19H21F2NO3S and a molecular weight of 381.44 g/mol. Its IUPAC name is 4-(difluoromethylsulfonylmethyl)-N-[(1S)-1-(4-ethylphenyl)ethyl]benzamide.
| Compound Name | 4-(difluoromethylsulfonylmethyl)-N-[(1S)-1-(4-ethylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 96534711 |
| Molecular Formula | C19H21F2NO3S |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 4-(difluoromethylsulfonylmethyl)-N-[(1S)-1-(4-ethylphenyl)ethyl]benzamide |
| SMILES | CCc1ccc([C@H](C)NC(=O)c2ccc(CS(=O)(=O)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H21F2NO3S/c1-3-14-4-8-16(9-5-14)13(2)22-18(23)17-10-6-15(7-11-17)12-26(24,25)19(20)21/h4-11,13,19H,3,12H2,1-2H3,(H,22,23)/t13-/m0/s1 |
| InChIKey | KXXKCDDZGJEWCM-ZDUSSCGKSA-N |
| XLogP | 3.88 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |