C25H39N3O3 — CID 96534867
2-[(2R)-2-[(2R)-2-hydroxy-2-phenylethyl]azepan-1-yl]-N-[3-(2-oxoazepan-1-yl)propyl]acetamide (PubChem CID 96534867) has the molecular formula C25H39N3O3 and a molecular weight of 429.61 g/mol. Its IUPAC name is 2-[(2R)-2-[(2R)-2-hydroxy-2-phenylethyl]azepan-1-yl]-N-[3-(2-oxoazepan-1-yl)propyl]acetamide.
| Compound Name | 2-[(2R)-2-[(2R)-2-hydroxy-2-phenylethyl]azepan-1-yl]-N-[3-(2-oxoazepan-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 96534867 |
| Molecular Formula | C25H39N3O3 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.30 |
| IUPAC Name | 2-[(2R)-2-[(2R)-2-hydroxy-2-phenylethyl]azepan-1-yl]-N-[3-(2-oxoazepan-1-yl)propyl]acetamide |
| SMILES | O=C(CN1CCCCC[C@@H]1C[C@@H](O)c1ccccc1)NCCCN1CCCCCC1=O |
| InChI | InChI=1S/C25H39N3O3/c29-23(21-11-4-1-5-12-21)19-22-13-6-2-9-17-28(22)20-24(30)26-15-10-18-27-16-8-3-7-14-25(27)31/h1,4-5,11-12,22-23,29H,2-3,6-10,13-20H2,(H,26,30)/t22-,23-/m1/s1 |
| InChIKey | JYNYVMSFWXVRPG-DHIUTWEWSA-N |
| XLogP | 3.26 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|