C16H24N4O2 — CID 96535435
5-cyano-N-[(2S)-4-(dimethylamino)-2-ethoxybutyl]-6-methylpyridine-2-carboxamide (PubChem CID 96535435) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 5-cyano-N-[(2S)-4-(dimethylamino)-2-ethoxybutyl]-6-methylpyridine-2-carboxamide.
| Compound Name | 5-cyano-N-[(2S)-4-(dimethylamino)-2-ethoxybutyl]-6-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 96535435 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 5-cyano-N-[(2S)-4-(dimethylamino)-2-ethoxybutyl]-6-methylpyridine-2-carboxamide |
| SMILES | CCO[C@@H](CCN(C)C)CNC(=O)c1ccc(C#N)c(C)n1 |
| InChI | InChI=1S/C16H24N4O2/c1-5-22-14(8-9-20(3)4)11-18-16(21)15-7-6-13(10-17)12(2)19-15/h6-7,14H,5,8-9,11H2,1-4H3,(H,18,21)/t14-/m0/s1 |
| InChIKey | LGAIHFQZWCZFBC-AWEZNQCLSA-N |
| XLogP | 1.35 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |