C16H26N4O4 — CID 96535751
1-[(2S)-4-(dimethylamino)-2-ethoxybutyl]-3-(4-methyl-3-nitrophenyl)urea (PubChem CID 96535751) has the molecular formula C16H26N4O4 and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-[(2S)-4-(dimethylamino)-2-ethoxybutyl]-3-(4-methyl-3-nitrophenyl)urea.
| Compound Name | 1-[(2S)-4-(dimethylamino)-2-ethoxybutyl]-3-(4-methyl-3-nitrophenyl)urea |
|---|---|
| PubChem CID | 96535751 |
| Molecular Formula | C16H26N4O4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1-[(2S)-4-(dimethylamino)-2-ethoxybutyl]-3-(4-methyl-3-nitrophenyl)urea |
| SMILES | CCO[C@@H](CCN(C)C)CNC(=O)Nc1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H26N4O4/c1-5-24-14(8-9-19(3)4)11-17-16(21)18-13-7-6-12(2)15(10-13)20(22)23/h6-7,10,14H,5,8-9,11H2,1-4H3,(H2,17,18,21)/t14-/m0/s1 |
| InChIKey | VRWPIDBBEJHSIM-AWEZNQCLSA-N |
| XLogP | 2.38 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|