C17H17NO3S — CID 96536285
(4S,5S)-5-benzyl-4-(4-methylphenyl)sulfonyl-4,5-dihydro-1,3-oxazole (PubChem CID 96536285) has the molecular formula C17H17NO3S and a molecular weight of 315.39 g/mol. Its IUPAC name is (4S,5S)-5-benzyl-4-(4-methylphenyl)sulfonyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S,5S)-5-benzyl-4-(4-methylphenyl)sulfonyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 96536285 |
| Molecular Formula | C17H17NO3S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | (4S,5S)-5-benzyl-4-(4-methylphenyl)sulfonyl-4,5-dihydro-1,3-oxazole |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H]2N=CO[C@H]2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C17H17NO3S/c1-13-7-9-15(10-8-13)22(19,20)17-16(21-12-18-17)11-14-5-3-2-4-6-14/h2-10,12,16-17H,11H2,1H3/t16-,17-/m0/s1 |
| InChIKey | ZVQGVSDKKAIHPA-IRXDYDNUSA-N |
| XLogP | 2.76 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |