C20H28N4O2 — CID 96537661
(2S)-N-[(8S)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-2-(3-propan-2-ylphenoxy)propanamide (PubChem CID 96537661) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is (2S)-N-[(8S)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-2-(3-propan-2-ylphenoxy)propanamide.
| Compound Name | (2S)-N-[(8S)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-2-(3-propan-2-ylphenoxy)propanamide |
|---|---|
| PubChem CID | 96537661 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | (2S)-N-[(8S)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-2-(3-propan-2-ylphenoxy)propanamide |
| SMILES | CCc1nc2n(n1)CCC[C@@H]2NC(=O)[C@H](C)Oc1cccc(C(C)C)c1 |
| InChI | InChI=1S/C20H28N4O2/c1-5-18-22-19-17(10-7-11-24(19)23-18)21-20(25)14(4)26-16-9-6-8-15(12-16)13(2)3/h6,8-9,12-14,17H,5,7,10-11H2,1-4H3,(H,21,25)/t14-,17-/m0/s1 |
| InChIKey | AERIAOVIQZQVNF-YOEHRIQHSA-N |
| XLogP | 3.38 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |