About 1-[1-[(3S)-1,1-dioxothiolan-3-yl]pyrazol-4-yl]-N-[(4-phenyloxan-4-yl)methyl]methanamine
1-[1-[(3S)-1,1-dioxothiolan-3-yl]pyrazol-4-yl]-N-[(4-phenyloxan-4-yl)methyl]methanamine (PubChem CID 96540881) has the molecular formula C20H27N3O3S
and a molecular weight of 389.52 g/mol. Its IUPAC name is 1-[1-[(3S)-1,1-dioxothiolan-3-yl]pyrazol-4-yl]-N-[(4-phenyloxan-4-yl)methyl]methanamine.
Molecular Properties
| Compound Name | 1-[1-[(3S)-1,1-dioxothiolan-3-yl]pyrazol-4-yl]-N-[(4-phenyloxan-4-yl)methyl]methanamine |
| PubChem CID | 96540881 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 1-[1-[(3S)-1,1-dioxothiolan-3-yl]pyrazol-4-yl]-N-[(4-phenyloxan-4-yl)methyl]methanamine |
| SMILES | O=S1(=O)CC[C@H](n2cc(CNCC3(c4ccccc4)CCOCC3)cn2)C1 |
| InChI | InChI=1S/C20H27N3O3S/c24-27(25)11-6-19(15-27)23-14-17(13-22-23)12-21-16-20(7-9-26-10-8-20)18-4-2-1-3-5-18/h1-5,13-14,19,21H,6-12,15-16H2/t19-/m0/s1 |
| InChIKey | ZYJSGHCGOJXDKP-IBGZPJMESA-N |
| XLogP | 2.08 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[1-[(3S)-1,1-dioxothiolan-3-yl]pyrazol-4-yl]-N-[(4-phenyloxan-4-yl)methyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[(3S)-1,1-dioxothiolan-3-yl]pyrazol-4-yl]-N-[(4-phenyloxan-4-yl)methyl]methanamine?
The IUPAC name of 1-[1-[(3S)-1,1-dioxothiolan-3-yl]pyrazol-4-yl]-N-[(4-phenyloxan-4-yl)methyl]methanamine (CID 96540881) is 1-[1-[(3S)-1,1-dioxothiolan-3-yl]pyrazol-4-yl]-N-[(4-phenyloxan-4-yl)methyl]methanamine.
What is the SMILES notation for 1-[1-[(3S)-1,1-dioxothiolan-3-yl]pyrazol-4-yl]-N-[(4-phenyloxan-4-yl)methyl]methanamine?
The canonical SMILES for 1-[1-[(3S)-1,1-dioxothiolan-3-yl]pyrazol-4-yl]-N-[(4-phenyloxan-4-yl)methyl]methanamine is O=S1(=O)CC[C@H](n2cc(CNCC3(c4ccccc4)CCOCC3)cn2)C1.
What is the InChIKey of 1-[1-[(3S)-1,1-dioxothiolan-3-yl]pyrazol-4-yl]-N-[(4-phenyloxan-4-yl)methyl]methanamine?
The InChIKey is ZYJSGHCGOJXDKP-IBGZPJMESA-N. The full InChI is InChI=1S/C20H27N3O3S/c24-27(25)11-6-19(15-27)23-14-17(13-22-23)12-21-16-20(7-9-26-10-8-20)18-4-2-1-3-5-18/h1-5,13-14,19,21H,6-12,15-16H2/t19-/m0/s1.
What are the key properties of 1-[1-[(3S)-1,1-dioxothiolan-3-yl]pyrazol-4-yl]-N-[(4-phenyloxan-4-yl)methyl]methanamine?
1-[1-[(3S)-1,1-dioxothiolan-3-yl]pyrazol-4-yl]-N-[(4-phenyloxan-4-yl)methyl]methanamine has a molecular weight of 389.52 g/mol, XLogP of 2.08, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[(3S)-1,1-dioxothiolan-3-yl]pyrazol-4-yl]-N-[(4-phenyloxan-4-yl)methyl]methanamine is sourced from PubChem (CID 96540881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).