C21H35N3O5S — CID 96541803
tert-butyl N-[(2S)-2-cyclopropyl-2-[2-[4-(dimethylsulfamoyl)phenoxy]ethylamino]propyl]carbamate (PubChem CID 96541803) has the molecular formula C21H35N3O5S and a molecular weight of 441.59 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-cyclopropyl-2-[2-[4-(dimethylsulfamoyl)phenoxy]ethylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-cyclopropyl-2-[2-[4-(dimethylsulfamoyl)phenoxy]ethylamino]propyl]carbamate |
|---|---|
| PubChem CID | 96541803 |
| Molecular Formula | C21H35N3O5S |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | tert-butyl N-[(2S)-2-cyclopropyl-2-[2-[4-(dimethylsulfamoyl)phenoxy]ethylamino]propyl]carbamate |
| SMILES | CN(C)S(=O)(=O)c1ccc(OCCN[C@](C)(CNC(=O)OC(C)(C)C)C2CC2)cc1 |
| InChI | InChI=1S/C21H35N3O5S/c1-20(2,3)29-19(25)22-15-21(4,16-7-8-16)23-13-14-28-17-9-11-18(12-10-17)30(26,27)24(5)6/h9-12,16,23H,7-8,13-15H2,1-6H3,(H,22,25)/t21-/m1/s1 |
| InChIKey | AUVVUMQGCRUKOC-OAQYLSRUSA-N |
| XLogP | 2.60 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|