C12H15FN2O3 — CID 96542885
(2S)-2-cyclopropyl-2-(2-fluoro-4-nitroanilino)propan-1-ol (PubChem CID 96542885) has the molecular formula C12H15FN2O3 and a molecular weight of 254.26 g/mol. Its IUPAC name is (2S)-2-cyclopropyl-2-(2-fluoro-4-nitroanilino)propan-1-ol.
| Compound Name | (2S)-2-cyclopropyl-2-(2-fluoro-4-nitroanilino)propan-1-ol |
|---|---|
| PubChem CID | 96542885 |
| Molecular Formula | C12H15FN2O3 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (2S)-2-cyclopropyl-2-(2-fluoro-4-nitroanilino)propan-1-ol |
| SMILES | C[C@](CO)(Nc1ccc([N+](=O)[O-])cc1F)C1CC1 |
| InChI | InChI=1S/C12H15FN2O3/c1-12(7-16,8-2-3-8)14-11-5-4-9(15(17)18)6-10(11)13/h4-6,8,14,16H,2-3,7H2,1H3/t12-/m1/s1 |
| InChIKey | WKEPSDGJONFQDX-GFCCVEGCSA-N |
| XLogP | 2.31 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|