C18H25N3O — CID 96542989
1-[(3R,4S)-1-benzyl-3-methylpiperidin-4-yl]-1-methyl-3-prop-2-ynylurea (PubChem CID 96542989) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 1-[(3R,4S)-1-benzyl-3-methylpiperidin-4-yl]-1-methyl-3-prop-2-ynylurea.
| Compound Name | 1-[(3R,4S)-1-benzyl-3-methylpiperidin-4-yl]-1-methyl-3-prop-2-ynylurea |
|---|---|
| PubChem CID | 96542989 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 1-[(3R,4S)-1-benzyl-3-methylpiperidin-4-yl]-1-methyl-3-prop-2-ynylurea |
| SMILES | C#CCNC(=O)N(C)[C@H]1CCN(Cc2ccccc2)C[C@H]1C |
| InChI | InChI=1S/C18H25N3O/c1-4-11-19-18(22)20(3)17-10-12-21(13-15(17)2)14-16-8-6-5-7-9-16/h1,5-9,15,17H,10-14H2,2-3H3,(H,19,22)/t15-,17+/m1/s1 |
| InChIKey | UFZQCSMMCUVROU-WBVHZDCISA-N |
| XLogP | 2.17 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|