C21H28N2O3 — CID 96544219
(4S,5R)-4-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carbonyl]-1-methyl-5-phenylpyrrolidin-2-one (PubChem CID 96544219) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is (4S,5R)-4-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carbonyl]-1-methyl-5-phenylpyrrolidin-2-one.
| Compound Name | (4S,5R)-4-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carbonyl]-1-methyl-5-phenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 96544219 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | (4S,5R)-4-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carbonyl]-1-methyl-5-phenylpyrrolidin-2-one |
| SMILES | CN1C(=O)C[C@H](C(=O)N2CC[C@@]3(O)CCCC[C@H]3C2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H28N2O3/c1-22-18(24)13-17(19(22)15-7-3-2-4-8-15)20(25)23-12-11-21(26)10-6-5-9-16(21)14-23/h2-4,7-8,16-17,19,26H,5-6,9-14H2,1H3/t16-,17-,19-,21-/m0/s1 |
| InChIKey | REZBKXLWJJWOSH-VKRLORBYSA-N |
| XLogP | 2.36 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |