C27H20O10 — CID 96544306
dimethyl 5-[5-[(2S,3R)-2-methoxycarbonyl-4-oxo-2,3-dihydrofuro[3,2-c]chromen-3-yl]furan-2-yl]benzene-1,3-dicarboxylate (PubChem CID 96544306) has the molecular formula C27H20O10 and a molecular weight of 504.45 g/mol. Its IUPAC name is dimethyl 5-[5-[(2S,3R)-2-methoxycarbonyl-4-oxo-2,3-dihydrofuro[3,2-c]chromen-3-yl]furan-2-yl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[5-[(2S,3R)-2-methoxycarbonyl-4-oxo-2,3-dihydrofuro[3,2-c]chromen-3-yl]furan-2-yl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 96544306 |
| Molecular Formula | C27H20O10 |
| Molecular Weight | 504.45 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | dimethyl 5-[5-[(2S,3R)-2-methoxycarbonyl-4-oxo-2,3-dihydrofuro[3,2-c]chromen-3-yl]furan-2-yl]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(-c2ccc([C@@H]3c4c(c5ccccc5oc4=O)O[C@@H]3C(=O)OC)o2)c1 |
| InChI | InChI=1S/C27H20O10/c1-32-24(28)14-10-13(11-15(12-14)25(29)33-2)17-8-9-19(35-17)20-21-22(37-23(20)27(31)34-3)16-6-4-5-7-18(16)36-26(21)30/h4-12,20,23H,1-3H3/t20-,23+/m1/s1 |
| InChIKey | KDFYCOYBROSTIM-OFNKIYASSA-N |
| XLogP | 3.69 |
| TPSA | 131.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|