C15H19F4N3O — CID 96547909
(2R)-2-phenyl-2-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]acetamide (PubChem CID 96547909) has the molecular formula C15H19F4N3O and a molecular weight of 333.33 g/mol. Its IUPAC name is (2R)-2-phenyl-2-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]acetamide.
| Compound Name | (2R)-2-phenyl-2-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 96547909 |
| Molecular Formula | C15H19F4N3O |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (2R)-2-phenyl-2-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]acetamide |
| SMILES | NC(=O)[C@@H](c1ccccc1)N1CCN(CC(F)(F)C(F)F)CC1 |
| InChI | InChI=1S/C15H19F4N3O/c16-14(17)15(18,19)10-21-6-8-22(9-7-21)12(13(20)23)11-4-2-1-3-5-11/h1-5,12,14H,6-10H2,(H2,20,23)/t12-/m1/s1 |
| InChIKey | MVFUVOJAZDYOCG-GFCCVEGCSA-N |
| XLogP | 1.73 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|