C19H25N3O3 — CID 96548725
tert-butyl N-[[(3R)-1-(1H-indole-2-carbonyl)pyrrolidin-3-yl]methyl]carbamate (PubChem CID 96548725) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is tert-butyl N-[[(3R)-1-(1H-indole-2-carbonyl)pyrrolidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(3R)-1-(1H-indole-2-carbonyl)pyrrolidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 96548725 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | tert-butyl N-[[(3R)-1-(1H-indole-2-carbonyl)pyrrolidin-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@H]1CCN(C(=O)c2cc3ccccc3[nH]2)C1 |
| InChI | InChI=1S/C19H25N3O3/c1-19(2,3)25-18(24)20-11-13-8-9-22(12-13)17(23)16-10-14-6-4-5-7-15(14)21-16/h4-7,10,13,21H,8-9,11-12H2,1-3H3,(H,20,24)/t13-/m1/s1 |
| InChIKey | XFDNWZJVQGABLS-CYBMUJFWSA-N |
| XLogP | 3.15 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |