About 1-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-3-[(6-methyl-3-pyridinyl)methyl]urea
1-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-3-[(6-methyl-3-pyridinyl)methyl]urea (PubChem CID 96548928) has the molecular formula C17H19F2N3O2
and a molecular weight of 335.35 g/mol. Its IUPAC name is 1-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-3-[(6-methyl-3-pyridinyl)methyl]urea.
Molecular Properties
| Compound Name | 1-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-3-[(6-methyl-3-pyridinyl)methyl]urea |
| PubChem CID | 96548928 |
| Molecular Formula | C17H19F2N3O2 |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 1-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-3-[(6-methyl-3-pyridinyl)methyl]urea |
| SMILES | Cc1ccc(CNC(=O)NC[C@](C)(O)c2ccc(F)cc2F)cn1 |
| InChI | InChI=1S/C17H19F2N3O2/c1-11-3-4-12(8-20-11)9-21-16(23)22-10-17(2,24)14-6-5-13(18)7-15(14)19/h3-8,24H,9-10H2,1-2H3,(H2,21,22,23)/t17-/m0/s1 |
| InChIKey | HKKKCKUVSGRCSP-KRWDZBQOSA-N |
| XLogP | 2.38 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-3-[(6-methyl-3-pyridinyl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-3-[(6-methyl-3-pyridinyl)methyl]urea?
The IUPAC name of 1-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-3-[(6-methyl-3-pyridinyl)methyl]urea (CID 96548928) is 1-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-3-[(6-methyl-3-pyridinyl)methyl]urea.
What is the SMILES notation for 1-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-3-[(6-methyl-3-pyridinyl)methyl]urea?
The canonical SMILES for 1-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-3-[(6-methyl-3-pyridinyl)methyl]urea is Cc1ccc(CNC(=O)NC[C@](C)(O)c2ccc(F)cc2F)cn1.
What is the InChIKey of 1-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-3-[(6-methyl-3-pyridinyl)methyl]urea?
The InChIKey is HKKKCKUVSGRCSP-KRWDZBQOSA-N. The full InChI is InChI=1S/C17H19F2N3O2/c1-11-3-4-12(8-20-11)9-21-16(23)22-10-17(2,24)14-6-5-13(18)7-15(14)19/h3-8,24H,9-10H2,1-2H3,(H2,21,22,23)/t17-/m0/s1.
What are the key properties of 1-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-3-[(6-methyl-3-pyridinyl)methyl]urea?
1-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-3-[(6-methyl-3-pyridinyl)methyl]urea has a molecular weight of 335.35 g/mol, XLogP of 2.38, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-3-[(6-methyl-3-pyridinyl)methyl]urea is sourced from PubChem (CID 96548928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).