C17H15ClN2O3 — CID 96549369
N-[(R)-(3-chlorophenyl)-cyanomethyl]-2,3-dimethoxybenzamide (PubChem CID 96549369) has the molecular formula C17H15ClN2O3 and a molecular weight of 330.77 g/mol. Its IUPAC name is N-[(R)-(3-chlorophenyl)-cyanomethyl]-2,3-dimethoxybenzamide.
| Compound Name | N-[(R)-(3-chlorophenyl)-cyanomethyl]-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 96549369 |
| Molecular Formula | C17H15ClN2O3 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | N-[(R)-(3-chlorophenyl)-cyanomethyl]-2,3-dimethoxybenzamide |
| SMILES | COc1cccc(C(=O)N[C@@H](C#N)c2cccc(Cl)c2)c1OC |
| InChI | InChI=1S/C17H15ClN2O3/c1-22-15-8-4-7-13(16(15)23-2)17(21)20-14(10-19)11-5-3-6-12(18)9-11/h3-9,14H,1-2H3,(H,20,21)/t14-/m0/s1 |
| InChIKey | LZXUPFXYBWDDEH-AWEZNQCLSA-N |
| XLogP | 3.35 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |