C19H23FN2O3 — CID 96549747
(2S)-N-[(2-fluorophenyl)methyl]-2-[4-(2-methoxyethoxy)anilino]propanamide (PubChem CID 96549747) has the molecular formula C19H23FN2O3 and a molecular weight of 346.40 g/mol. Its IUPAC name is (2S)-N-[(2-fluorophenyl)methyl]-2-[4-(2-methoxyethoxy)anilino]propanamide.
| Compound Name | (2S)-N-[(2-fluorophenyl)methyl]-2-[4-(2-methoxyethoxy)anilino]propanamide |
|---|---|
| PubChem CID | 96549747 |
| Molecular Formula | C19H23FN2O3 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | (2S)-N-[(2-fluorophenyl)methyl]-2-[4-(2-methoxyethoxy)anilino]propanamide |
| SMILES | COCCOc1ccc(N[C@@H](C)C(=O)NCc2ccccc2F)cc1 |
| InChI | InChI=1S/C19H23FN2O3/c1-14(19(23)21-13-15-5-3-4-6-18(15)20)22-16-7-9-17(10-8-16)25-12-11-24-2/h3-10,14,22H,11-13H2,1-2H3,(H,21,23)/t14-/m0/s1 |
| InChIKey | UDOXOJLZQIPLDL-AWEZNQCLSA-N |
| XLogP | 2.97 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|