About (2R,6R)-2,6-bis(trifluoromethyl)piperidine
(2R,6R)-2,6-bis(trifluoromethyl)piperidine (PubChem CID 96551753) has the molecular formula C7H9F6N
and a molecular weight of 221.14 g/mol. Its IUPAC name is (2R,6R)-2,6-bis(trifluoromethyl)piperidine.
Molecular Properties
| Compound Name | (2R,6R)-2,6-bis(trifluoromethyl)piperidine |
| PubChem CID | 96551753 |
| Molecular Formula | C7H9F6N |
| Molecular Weight | 221.14 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | (2R,6R)-2,6-bis(trifluoromethyl)piperidine |
| SMILES | FC(F)(F)[C@H]1CCC[C@H](C(F)(F)F)N1 |
| InChI | InChI=1S/C7H9F6N/c8-6(9,10)4-2-1-3-5(14-4)7(11,12)13/h4-5,14H,1-3H2/t4-,5-/m1/s1 |
| InChIKey | APPHZZVNZFLFTE-RFZPGFLSSA-N |
| XLogP | 2.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.14 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R,6R)-2,6-bis(trifluoromethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6R)-2,6-bis(trifluoromethyl)piperidine?
The IUPAC name of (2R,6R)-2,6-bis(trifluoromethyl)piperidine (CID 96551753) is (2R,6R)-2,6-bis(trifluoromethyl)piperidine.
What is the SMILES notation for (2R,6R)-2,6-bis(trifluoromethyl)piperidine?
The canonical SMILES for (2R,6R)-2,6-bis(trifluoromethyl)piperidine is FC(F)(F)[C@H]1CCC[C@H](C(F)(F)F)N1.
What is the InChIKey of (2R,6R)-2,6-bis(trifluoromethyl)piperidine?
The InChIKey is APPHZZVNZFLFTE-RFZPGFLSSA-N. The full InChI is InChI=1S/C7H9F6N/c8-6(9,10)4-2-1-3-5(14-4)7(11,12)13/h4-5,14H,1-3H2/t4-,5-/m1/s1.
What are the key properties of (2R,6R)-2,6-bis(trifluoromethyl)piperidine?
(2R,6R)-2,6-bis(trifluoromethyl)piperidine has a molecular weight of 221.14 g/mol, XLogP of 2.62, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6R)-2,6-bis(trifluoromethyl)piperidine is sourced from PubChem (CID 96551753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).