C16H31N3O3 — CID 96552208
tert-butyl (3S)-3-[[[(2S)-2-amino-3-methylbutanoyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 96552208) has the molecular formula C16H31N3O3 and a molecular weight of 313.44 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[[(2S)-2-amino-3-methylbutanoyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[[(2S)-2-amino-3-methylbutanoyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 96552208 |
| Molecular Formula | C16H31N3O3 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | tert-butyl (3S)-3-[[[(2S)-2-amino-3-methylbutanoyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)[C@H](N)C(=O)NC[C@@H]1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H31N3O3/c1-11(2)13(17)14(20)18-9-12-7-6-8-19(10-12)15(21)22-16(3,4)5/h11-13H,6-10,17H2,1-5H3,(H,18,20)/t12-,13-/m0/s1 |
| InChIKey | KKVMIKVNLQKLPX-STQMWFEESA-N |
| XLogP | 1.73 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |