C12H23ClN2O — CID 96553335
2-chloro-N-[(1R,2S)-2-(dimethylamino)cyclohexyl]-N-ethylacetamide (PubChem CID 96553335) has the molecular formula C12H23ClN2O and a molecular weight of 246.78 g/mol. Its IUPAC name is 2-chloro-N-[(1R,2S)-2-(dimethylamino)cyclohexyl]-N-ethylacetamide.
| Compound Name | 2-chloro-N-[(1R,2S)-2-(dimethylamino)cyclohexyl]-N-ethylacetamide |
|---|---|
| PubChem CID | 96553335 |
| Molecular Formula | C12H23ClN2O |
| Molecular Weight | 246.78 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 2-chloro-N-[(1R,2S)-2-(dimethylamino)cyclohexyl]-N-ethylacetamide |
| SMILES | CCN(C(=O)CCl)[C@@H]1CCCC[C@@H]1N(C)C |
| InChI | InChI=1S/C12H23ClN2O/c1-4-15(12(16)9-13)11-8-6-5-7-10(11)14(2)3/h10-11H,4-9H2,1-3H3/t10-,11+/m0/s1 |
| InChIKey | FBHJEFCCGRIVEX-WDEREUQCSA-N |
| XLogP | 1.95 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.78 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|