C22H18N2O7S — CID 96557730
(1R,13S,17S)-11-amino-15-(2,5-dimethoxyphenyl)-5-hydroxy-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-9,14,16-trione (PubChem CID 96557730) has the molecular formula C22H18N2O7S and a molecular weight of 454.46 g/mol. Its IUPAC name is (1R,13S,17S)-11-amino-15-(2,5-dimethoxyphenyl)-5-hydroxy-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-9,14,16-trione.
| Compound Name | (1R,13S,17S)-11-amino-15-(2,5-dimethoxyphenyl)-5-hydroxy-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-9,14,16-trione |
|---|---|
| PubChem CID | 96557730 |
| Molecular Formula | C22H18N2O7S |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | (1R,13S,17S)-11-amino-15-(2,5-dimethoxyphenyl)-5-hydroxy-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-9,14,16-trione |
| SMILES | COc1ccc(OC)c(N2C(=O)[C@H]3[C@H](SC(N)=C4C(=O)Oc5cc(O)ccc5[C@H]43)C2=O)c1 |
| InChI | InChI=1S/C22H18N2O7S/c1-29-10-4-6-13(30-2)12(8-10)24-20(26)16-15-11-5-3-9(25)7-14(11)31-22(28)17(15)19(23)32-18(16)21(24)27/h3-8,15-16,18,25H,23H2,1-2H3/t15-,16+,18-/m0/s1 |
| InChIKey | YVAISEJIQGBIRF-JZXOWHBKSA-N |
| XLogP | 1.89 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|