C16H28N2O3S3 — CID 96558211
1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-5-[(3S)-dithiolan-3-yl]pentan-1-one (PubChem CID 96558211) has the molecular formula C16H28N2O3S3 and a molecular weight of 392.61 g/mol. Its IUPAC name is 1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-5-[(3S)-dithiolan-3-yl]pentan-1-one.
| Compound Name | 1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-5-[(3S)-dithiolan-3-yl]pentan-1-one |
|---|---|
| PubChem CID | 96558211 |
| Molecular Formula | C16H28N2O3S3 |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-5-[(3S)-dithiolan-3-yl]pentan-1-one |
| SMILES | O=C(CCCC[C@H]1CCSS1)N1CCN([C@H]2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C16H28N2O3S3/c19-16(4-2-1-3-15-5-11-22-23-15)18-9-7-17(8-10-18)14-6-12-24(20,21)13-14/h14-15H,1-13H2/t14-,15-/m0/s1 |
| InChIKey | SCFJBOGBFPWPLA-GJZGRUSLSA-N |
| XLogP | 2.03 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|