About 1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-5-[(3S)-dithiolan-3-yl]pentan-1-one
1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-5-[(3S)-dithiolan-3-yl]pentan-1-one (PubChem CID 96558211) has the molecular formula C16H28N2O3S3
and a molecular weight of 392.61 g/mol. Its IUPAC name is 1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-5-[(3S)-dithiolan-3-yl]pentan-1-one.
Molecular Properties
| Compound Name | 1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-5-[(3S)-dithiolan-3-yl]pentan-1-one |
| PubChem CID | 96558211 |
| Molecular Formula | C16H28N2O3S3 |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-5-[(3S)-dithiolan-3-yl]pentan-1-one |
| SMILES | O=C(CCCC[C@H]1CCSS1)N1CCN([C@H]2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C16H28N2O3S3/c19-16(4-2-1-3-15-5-11-22-23-15)18-9-7-17(8-10-18)14-6-12-24(20,21)13-14/h14-15H,1-13H2/t14-,15-/m0/s1 |
| InChIKey | SCFJBOGBFPWPLA-GJZGRUSLSA-N |
| XLogP | 2.03 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-5-[(3S)-dithiolan-3-yl]pentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-5-[(3S)-dithiolan-3-yl]pentan-1-one?
The IUPAC name of 1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-5-[(3S)-dithiolan-3-yl]pentan-1-one (CID 96558211) is 1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-5-[(3S)-dithiolan-3-yl]pentan-1-one.
What is the SMILES notation for 1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-5-[(3S)-dithiolan-3-yl]pentan-1-one?
The canonical SMILES for 1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-5-[(3S)-dithiolan-3-yl]pentan-1-one is O=C(CCCC[C@H]1CCSS1)N1CCN([C@H]2CCS(=O)(=O)C2)CC1.
What is the InChIKey of 1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-5-[(3S)-dithiolan-3-yl]pentan-1-one?
The InChIKey is SCFJBOGBFPWPLA-GJZGRUSLSA-N. The full InChI is InChI=1S/C16H28N2O3S3/c19-16(4-2-1-3-15-5-11-22-23-15)18-9-7-17(8-10-18)14-6-12-24(20,21)13-14/h14-15H,1-13H2/t14-,15-/m0/s1.
What are the key properties of 1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-5-[(3S)-dithiolan-3-yl]pentan-1-one?
1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-5-[(3S)-dithiolan-3-yl]pentan-1-one has a molecular weight of 392.61 g/mol, XLogP of 2.03, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-5-[(3S)-dithiolan-3-yl]pentan-1-one is sourced from PubChem (CID 96558211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).