C18H27N3O2S — CID 96560497
(E)-N-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enamide (PubChem CID 96560497) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is (E)-N-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enamide.
| Compound Name | (E)-N-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 96560497 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (E)-N-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enamide |
| SMILES | CC(C)(C)c1ncc(/C=C/C(=O)NC[C@@H]2CN3CCC[C@@H]3CO2)s1 |
| InChI | InChI=1S/C18H27N3O2S/c1-18(2,3)17-20-10-15(24-17)6-7-16(22)19-9-14-11-21-8-4-5-13(21)12-23-14/h6-7,10,13-14H,4-5,8-9,11-12H2,1-3H3,(H,19,22)/b7-6+/t13-,14-/m1/s1 |
| InChIKey | FXGDFCKNNRWKCW-JLVOYYQZSA-N |
| XLogP | 2.43 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|