C18H31N5O2 — CID 96562960
1-[(1R,3R)-3-ethoxy-2,2-diethylcyclobutyl]-3-[(8R)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-yl]urea (PubChem CID 96562960) has the molecular formula C18H31N5O2 and a molecular weight of 349.48 g/mol. Its IUPAC name is 1-[(1R,3R)-3-ethoxy-2,2-diethylcyclobutyl]-3-[(8R)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-yl]urea.
| Compound Name | 1-[(1R,3R)-3-ethoxy-2,2-diethylcyclobutyl]-3-[(8R)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-yl]urea |
|---|---|
| PubChem CID | 96562960 |
| Molecular Formula | C18H31N5O2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | 1-[(1R,3R)-3-ethoxy-2,2-diethylcyclobutyl]-3-[(8R)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-yl]urea |
| SMILES | CCO[C@@H]1C[C@@H](NC(=O)N[C@@H]2CCCn3c(C)nnc32)C1(CC)CC |
| InChI | InChI=1S/C18H31N5O2/c1-5-18(6-2)14(11-15(18)25-7-3)20-17(24)19-13-9-8-10-23-12(4)21-22-16(13)23/h13-15H,5-11H2,1-4H3,(H2,19,20,24)/t13-,14-,15-/m1/s1 |
| InChIKey | CPVMDOQBIVXLDQ-RBSFLKMASA-N |
| XLogP | 2.70 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |