About (2S)-2-[[4,6-dimethyl-5-(2-methylpropyl)pyrimidin-2-yl]amino]-1-piperidin-1-ylpropan-1-one
(2S)-2-[[4,6-dimethyl-5-(2-methylpropyl)pyrimidin-2-yl]amino]-1-piperidin-1-ylpropan-1-one (PubChem CID 96563196) has the molecular formula C18H30N4O
and a molecular weight of 318.47 g/mol. Its IUPAC name is (2S)-2-[[4,6-dimethyl-5-(2-methylpropyl)pyrimidin-2-yl]amino]-1-piperidin-1-ylpropan-1-one.
Molecular Properties
| Compound Name | (2S)-2-[[4,6-dimethyl-5-(2-methylpropyl)pyrimidin-2-yl]amino]-1-piperidin-1-ylpropan-1-one |
| PubChem CID | 96563196 |
| Molecular Formula | C18H30N4O |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | (2S)-2-[[4,6-dimethyl-5-(2-methylpropyl)pyrimidin-2-yl]amino]-1-piperidin-1-ylpropan-1-one |
| SMILES | Cc1nc(N[C@@H](C)C(=O)N2CCCCC2)nc(C)c1CC(C)C |
| InChI | InChI=1S/C18H30N4O/c1-12(2)11-16-13(3)19-18(20-14(16)4)21-15(5)17(23)22-9-7-6-8-10-22/h12,15H,6-11H2,1-5H3,(H,19,20,21)/t15-/m0/s1 |
| InChIKey | WOAPKAKUOFFMCQ-HNNXBMFYSA-N |
| XLogP | 3.10 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-[[4,6-dimethyl-5-(2-methylpropyl)pyrimidin-2-yl]amino]-1-piperidin-1-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[[4,6-dimethyl-5-(2-methylpropyl)pyrimidin-2-yl]amino]-1-piperidin-1-ylpropan-1-one?
The IUPAC name of (2S)-2-[[4,6-dimethyl-5-(2-methylpropyl)pyrimidin-2-yl]amino]-1-piperidin-1-ylpropan-1-one (CID 96563196) is (2S)-2-[[4,6-dimethyl-5-(2-methylpropyl)pyrimidin-2-yl]amino]-1-piperidin-1-ylpropan-1-one.
What is the SMILES notation for (2S)-2-[[4,6-dimethyl-5-(2-methylpropyl)pyrimidin-2-yl]amino]-1-piperidin-1-ylpropan-1-one?
The canonical SMILES for (2S)-2-[[4,6-dimethyl-5-(2-methylpropyl)pyrimidin-2-yl]amino]-1-piperidin-1-ylpropan-1-one is Cc1nc(N[C@@H](C)C(=O)N2CCCCC2)nc(C)c1CC(C)C.
What is the InChIKey of (2S)-2-[[4,6-dimethyl-5-(2-methylpropyl)pyrimidin-2-yl]amino]-1-piperidin-1-ylpropan-1-one?
The InChIKey is WOAPKAKUOFFMCQ-HNNXBMFYSA-N. The full InChI is InChI=1S/C18H30N4O/c1-12(2)11-16-13(3)19-18(20-14(16)4)21-15(5)17(23)22-9-7-6-8-10-22/h12,15H,6-11H2,1-5H3,(H,19,20,21)/t15-/m0/s1.
What are the key properties of (2S)-2-[[4,6-dimethyl-5-(2-methylpropyl)pyrimidin-2-yl]amino]-1-piperidin-1-ylpropan-1-one?
(2S)-2-[[4,6-dimethyl-5-(2-methylpropyl)pyrimidin-2-yl]amino]-1-piperidin-1-ylpropan-1-one has a molecular weight of 318.47 g/mol, XLogP of 3.10, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[[4,6-dimethyl-5-(2-methylpropyl)pyrimidin-2-yl]amino]-1-piperidin-1-ylpropan-1-one is sourced from PubChem (CID 96563196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).