C21H18ClN3O — CID 96563862
2-[(2R,6R)-2-(4-chlorophenyl)-4-pyridin-3-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol (PubChem CID 96563862) has the molecular formula C21H18ClN3O and a molecular weight of 363.85 g/mol. Its IUPAC name is 2-[(2R,6R)-2-(4-chlorophenyl)-4-pyridin-3-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol.
| Compound Name | 2-[(2R,6R)-2-(4-chlorophenyl)-4-pyridin-3-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
|---|---|
| PubChem CID | 96563862 |
| Molecular Formula | C21H18ClN3O |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 2-[(2R,6R)-2-(4-chlorophenyl)-4-pyridin-3-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
| SMILES | Oc1ccccc1[C@H]1CC(c2cccnc2)=N[C@H](c2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C21H18ClN3O/c22-16-9-7-14(8-10-16)21-24-18(15-4-3-11-23-13-15)12-19(25-21)17-5-1-2-6-20(17)26/h1-11,13,19,21,25-26H,12H2/t19-,21+/m1/s1 |
| InChIKey | YSUSHDDSAGZFOT-CTNGQTDRSA-N |
| XLogP | 4.66 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|