C10H10BrNO5 — CID 96564388
(1R)-2-bromo-1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)ethanol (PubChem CID 96564388) has the molecular formula C10H10BrNO5 and a molecular weight of 304.10 g/mol. Its IUPAC name is (1R)-2-bromo-1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)ethanol.
| Compound Name | (1R)-2-bromo-1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)ethanol |
|---|---|
| PubChem CID | 96564388 |
| Molecular Formula | C10H10BrNO5 |
| Molecular Weight | 304.10 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | (1R)-2-bromo-1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)ethanol |
| SMILES | O=[N+]([O-])c1cc2c(cc1[C@@H](O)CBr)OCCO2 |
| InChI | InChI=1S/C10H10BrNO5/c11-5-8(13)6-3-9-10(17-2-1-16-9)4-7(6)12(14)15/h3-4,8,13H,1-2,5H2/t8-/m0/s1 |
| InChIKey | RSLHFPJTCMENQS-QMMMGPOBSA-N |
| XLogP | 1.79 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.10 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|