C14H17N5O2 — CID 96565011
(2R,3R)-2-(4-methylphenyl)-N-(2H-tetrazol-5-yl)oxane-3-carboxamide (PubChem CID 96565011) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is (2R,3R)-2-(4-methylphenyl)-N-(2H-tetrazol-5-yl)oxane-3-carboxamide.
| Compound Name | (2R,3R)-2-(4-methylphenyl)-N-(2H-tetrazol-5-yl)oxane-3-carboxamide |
|---|---|
| PubChem CID | 96565011 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | (2R,3R)-2-(4-methylphenyl)-N-(2H-tetrazol-5-yl)oxane-3-carboxamide |
| SMILES | Cc1ccc([C@@H]2OCCC[C@H]2C(=O)Nc2nn[nH]n2)cc1 |
| InChI | InChI=1S/C14H17N5O2/c1-9-4-6-10(7-5-9)12-11(3-2-8-21-12)13(20)15-14-16-18-19-17-14/h4-7,11-12H,2-3,8H2,1H3,(H2,15,16,17,18,19,20)/t11-,12+/m1/s1 |
| InChIKey | KTCXHJSANWKQSZ-NEPJUHHUSA-N |
| XLogP | 1.61 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |