About 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[(2S)-1-hydroxybutan-2-yl]urea
1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[(2S)-1-hydroxybutan-2-yl]urea (PubChem CID 96565962) has the molecular formula C11H19N3O2S
and a molecular weight of 257.36 g/mol. Its IUPAC name is 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[(2S)-1-hydroxybutan-2-yl]urea.
Molecular Properties
| Compound Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[(2S)-1-hydroxybutan-2-yl]urea |
| PubChem CID | 96565962 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[(2S)-1-hydroxybutan-2-yl]urea |
| SMILES | CCc1cnc(CNC(=O)N[C@@H](CC)CO)s1 |
| InChI | InChI=1S/C11H19N3O2S/c1-3-8(7-15)14-11(16)13-6-10-12-5-9(4-2)17-10/h5,8,15H,3-4,6-7H2,1-2H3,(H2,13,14,16)/t8-/m0/s1 |
| InChIKey | CZUOSBKXXNVUBB-QMMMGPOBSA-N |
| XLogP | 1.28 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[(2S)-1-hydroxybutan-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[(2S)-1-hydroxybutan-2-yl]urea?
The IUPAC name of 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[(2S)-1-hydroxybutan-2-yl]urea (CID 96565962) is 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[(2S)-1-hydroxybutan-2-yl]urea.
What is the SMILES notation for 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[(2S)-1-hydroxybutan-2-yl]urea?
The canonical SMILES for 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[(2S)-1-hydroxybutan-2-yl]urea is CCc1cnc(CNC(=O)N[C@@H](CC)CO)s1.
What is the InChIKey of 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[(2S)-1-hydroxybutan-2-yl]urea?
The InChIKey is CZUOSBKXXNVUBB-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H19N3O2S/c1-3-8(7-15)14-11(16)13-6-10-12-5-9(4-2)17-10/h5,8,15H,3-4,6-7H2,1-2H3,(H2,13,14,16)/t8-/m0/s1.
What are the key properties of 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[(2S)-1-hydroxybutan-2-yl]urea?
1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[(2S)-1-hydroxybutan-2-yl]urea has a molecular weight of 257.36 g/mol, XLogP of 1.28, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[(2S)-1-hydroxybutan-2-yl]urea is sourced from PubChem (CID 96565962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).