About (2S)-4-(3-ethyl-1,2,4-thiadiazol-5-yl)-2-methylmorpholine
(2S)-4-(3-ethyl-1,2,4-thiadiazol-5-yl)-2-methylmorpholine (PubChem CID 96566785) has the molecular formula C9H15N3OS
and a molecular weight of 213.31 g/mol. Its IUPAC name is (2S)-4-(3-ethyl-1,2,4-thiadiazol-5-yl)-2-methylmorpholine.
Molecular Properties
| Compound Name | (2S)-4-(3-ethyl-1,2,4-thiadiazol-5-yl)-2-methylmorpholine |
| PubChem CID | 96566785 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | (2S)-4-(3-ethyl-1,2,4-thiadiazol-5-yl)-2-methylmorpholine |
| SMILES | CCc1nsc(N2CCO[C@@H](C)C2)n1 |
| InChI | InChI=1S/C9H15N3OS/c1-3-8-10-9(14-11-8)12-4-5-13-7(2)6-12/h7H,3-6H2,1-2H3/t7-/m0/s1 |
| InChIKey | IZMJXYGSAXGXSX-ZETCQYMHSA-N |
| XLogP | 1.33 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-4-(3-ethyl-1,2,4-thiadiazol-5-yl)-2-methylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-(3-ethyl-1,2,4-thiadiazol-5-yl)-2-methylmorpholine?
The IUPAC name of (2S)-4-(3-ethyl-1,2,4-thiadiazol-5-yl)-2-methylmorpholine (CID 96566785) is (2S)-4-(3-ethyl-1,2,4-thiadiazol-5-yl)-2-methylmorpholine.
What is the SMILES notation for (2S)-4-(3-ethyl-1,2,4-thiadiazol-5-yl)-2-methylmorpholine?
The canonical SMILES for (2S)-4-(3-ethyl-1,2,4-thiadiazol-5-yl)-2-methylmorpholine is CCc1nsc(N2CCO[C@@H](C)C2)n1.
What is the InChIKey of (2S)-4-(3-ethyl-1,2,4-thiadiazol-5-yl)-2-methylmorpholine?
The InChIKey is IZMJXYGSAXGXSX-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H15N3OS/c1-3-8-10-9(14-11-8)12-4-5-13-7(2)6-12/h7H,3-6H2,1-2H3/t7-/m0/s1.
What are the key properties of (2S)-4-(3-ethyl-1,2,4-thiadiazol-5-yl)-2-methylmorpholine?
(2S)-4-(3-ethyl-1,2,4-thiadiazol-5-yl)-2-methylmorpholine has a molecular weight of 213.31 g/mol, XLogP of 1.33, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-(3-ethyl-1,2,4-thiadiazol-5-yl)-2-methylmorpholine is sourced from PubChem (CID 96566785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).